data_bmse010352 ####################### # Entry information # ####################### save_entry_information _Entry.Sf_category entry_information _Entry.Sf_framecode entry_information _Entry.ID bmse010352 _Entry.Title lignin_cw_compound_3028 _Entry.Version_type update _Entry.Submission_date 2009-05-26 _Entry.Accession_date 2011-07-19 _Entry.Last_release_date 2013-04-05 _Entry.Original_release_date 2011-07-19 _Entry.Origination author _Entry.NMR_STAR_version 3.1.1.31 _Entry.Original_NMR_STAR_version 3.1.0.46 _Entry.Experimental_method NMR _Entry.Experimental_method_subtype solution _Entry.DOI 10.13018/BMSE010352 _Entry.Details ? _Entry.BMRB_internal_directory_name lignin_cw_compound_3028 loop_ _Entry_author.Ordinal _Entry_author.Given_name _Entry_author.Family_name _Entry_author.Middle_initials _Entry_author.Family_title _Entry_author.Entry_ID 1 Sally Ralph ? ? bmse010352 2 John Ralph ? ? bmse010352 stop_ loop_ _Entry_src.ID _Entry_src.Project_name _Entry_src.Organization_full_name _Entry_src.Organization_initials _Entry_src.Entry_ID 1 'NMR Database of Lignin and Cell Wall Model Compounds' 'United States Department of Agriculture' USDA bmse010352 stop_ loop_ _Data_set.Type _Data_set.Count _Data_set.Entry_ID assigned_chemical_shifts 3 bmse010352 stop_ loop_ _Datum.Type _Datum.Count _Datum.Entry_ID '13C chemical shifts' 66 bmse010352 '1H chemical shifts' 88 bmse010352 stop_ loop_ _Release.Release_number _Release.Format_type _Release.Format_version _Release.Date _Release.Submission_date _Release.Type _Release.Author _Release.Detail _Release.Entry_ID 1 . . 2011-07-19 2009-05-26 original Author 'Original spectra from USDA' bmse010352 2 . . 2011-09-07 2009-05-26 update BMRB 'Ensured correct reference IDs' bmse010352 3 . . 2011-09-09 2009-05-26 update BMRB 'Brought up to date with latest Dictionary' bmse010352 4 . . 2011-12-08 2009-05-26 update BMRB ; Changing chemcomp name from 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(2,5-dimethoxy-4-propylphenoxy)propan-1-ol for database consistency ; bmse010352 5 . . 2011-12-14 2009-05-26 update BMRB 'Set Assembly.Name to match Chem_comp.name' bmse010352 6 . . 2011-12-16 2009-05-26 update BMRB 'Standardized solvent' bmse010352 7 . . 2012-02-24 2009-05-26 update BMRB 'Set Raw_data_flag to no, since there are no raw data' bmse010352 8 . . 2013-04-05 2009-05-26 update BMRB 'Adding molecule category to chem_comp Details' bmse010352 9 . . 2017-10-12 2017-10-12 update BMRB 'Remediated Experiment_file loop if present and standardized mol and png file tags.' bmse010352 10 . . 2018-07-10 2017-10-12 update BMRB 'InChI numbering updated according to ALATIS' bmse010352 stop_ save_ ############### # Citations # ############### save_citation_1 _Citation.Sf_category citations _Citation.Sf_framecode citation_1 _Citation.Entry_ID bmse010352 _Citation.ID 1 _Citation.Class 'entry citation' _Citation.PubMed_ID ? _Citation.Title 'NMR Database of Lignin and Cell Wall Model Compounds.' _Citation.Status published _Citation.Type Internet _Citation.WWW_URL http://ars.usda.gov/Services/docs.htm?docid=10491 _Citation.Year 2004 _Citation.Details ? loop_ _Citation_author.Ordinal _Citation_author.Given_name _Citation_author.Family_name _Citation_author.First_initial _Citation_author.Middle_initials _Citation_author.Family_title _Citation_author.Entry_ID _Citation_author.Citation_ID 1 Sally Ralph ? A. ? bmse010352 1 2 John Ralph ? ? ? bmse010352 1 3 Larry Landucci ? L. ? bmse010352 1 stop_ save_ ############################################# # Molecular system (assembly) description # ############################################# save_assembly _Assembly.Sf_category assembly _Assembly.Sf_framecode assembly _Assembly.Entry_ID bmse010352 _Assembly.ID 1 _Assembly.Name lignin_cw_compound_3028 _Assembly.Number_of_components 1 _Assembly.Organic_ligands 0 _Assembly.Metal_ions ? _Assembly.Non_standard_bonds no _Assembly.Paramagnetic no _Assembly.Thiol_state 'not reported' loop_ _Entity_assembly.ID _Entity_assembly.Entity_assembly_name _Entity_assembly.Entity_ID _Entity_assembly.Entity_label _Entity_assembly.Experimental_data_reported _Entity_assembly.Physical_state _Entity_assembly.Conformational_isomer _Entity_assembly.Chemical_exchange_state _Entity_assembly.Magnetic_equivalence_group_code _Entity_assembly.Role _Entity_assembly.Details _Entity_assembly.Entry_ID _Entity_assembly.Assembly_ID 1 $lignin_cw_compound_3028 1 $lignin_cw_compound_3028 yes native no no ? ? ? bmse010352 1 stop_ save_ #################################### # Biological polymers and ligands # #################################### save_lignin_cw_compound_3028 _Entity.Sf_category entity _Entity.Sf_framecode lignin_cw_compound_3028 _Entity.Entry_ID bmse010352 _Entity.ID 1 _Entity.BMRB_code ? _Entity.Name ; 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(2,5-dimethoxy-4-propylphenoxy)propan-1-ol ; _Entity.Type non-polymer _Entity.Ambiguous_conformational_states no _Entity.Ambiguous_chem_comp_sites no _Entity.Nstd_monomer no _Entity.Nstd_chirality no _Entity.Nstd_linkage no _Entity.Paramagnetic no _Entity.Thiol_state 'not reported' loop_ _Entity_comp_index.ID _Entity_comp_index.Comp_ID _Entity_comp_index.Comp_label _Entity_comp_index.Entry_ID _Entity_comp_index.Entity_ID 1 1 $chem_comp_1 bmse010352 1 stop_ save_ #################### # Natural source # #################### save_natural_source _Entity_natural_src_list.Sf_category natural_source _Entity_natural_src_list.Sf_framecode natural_source _Entity_natural_src_list.Entry_ID bmse010352 _Entity_natural_src_list.ID 1 loop_ _Entity_natural_src.ID _Entity_natural_src.Entity_ID _Entity_natural_src.Entity_label _Entity_natural_src.Entity_chimera_segment_ID _Entity_natural_src.NCBI_taxonomy_ID _Entity_natural_src.Type _Entity_natural_src.Common _Entity_natural_src.Organism_name_scientific _Entity_natural_src.Organism_name_common _Entity_natural_src.Organism_acronym _Entity_natural_src.ICTVdb_decimal_code _Entity_natural_src.Superkingdom _Entity_natural_src.Kingdom _Entity_natural_src.Genus _Entity_natural_src.Species _Entity_natural_src.Strain _Entity_natural_src.Variant _Entity_natural_src.Subvariant _Entity_natural_src.Organ _Entity_natural_src.Tissue _Entity_natural_src.Tissue_fraction _Entity_natural_src.Cell_line _Entity_natural_src.Cell_type _Entity_natural_src.ATCC_number _Entity_natural_src.Organelle _Entity_natural_src.Cellular_location _Entity_natural_src.Fragment _Entity_natural_src.Fraction _Entity_natural_src.Secretion _Entity_natural_src.Plasmid _Entity_natural_src.Plasmid_details _Entity_natural_src.Gene_mnemonic _Entity_natural_src.Dev_stage _Entity_natural_src.Details _Entity_natural_src.Citation_ID _Entity_natural_src.Citation_label _Entity_natural_src.Entry_ID _Entity_natural_src.Entity_natural_src_list_ID 1 1 $lignin_cw_compound_3028 . n/a 'multiple natural sources' yes 'not applicable' n/a . . Eukaryota Viridiplantae n/a n/a . . . . . . . . . . . . . . . . . . . . . bmse010352 1 stop_ save_ ######################### # Experimental source # ######################### save_experimental_source _Entity_experimental_src_list.Sf_category experimental_source _Entity_experimental_src_list.Sf_framecode experimental_source _Entity_experimental_src_list.Entry_ID bmse010352 _Entity_experimental_src_list.ID 1 loop_ _Entity_experimental_src.ID _Entity_experimental_src.Entity_ID _Entity_experimental_src.Entity_label _Entity_experimental_src.Entity_chimera_segment_ID _Entity_experimental_src.Production_method _Entity_experimental_src.Host_org_scientific_name _Entity_experimental_src.Host_org_name_common _Entity_experimental_src.Host_org_details _Entity_experimental_src.Host_org_NCBI_taxonomy_ID _Entity_experimental_src.Host_org_genus _Entity_experimental_src.Host_org_species _Entity_experimental_src.Host_org_strain _Entity_experimental_src.Host_org_variant _Entity_experimental_src.Host_org_subvariant _Entity_experimental_src.Host_org_organ _Entity_experimental_src.Host_org_tissue _Entity_experimental_src.Host_org_tissue_fraction _Entity_experimental_src.Host_org_cell_line _Entity_experimental_src.Host_org_cell_type _Entity_experimental_src.Host_org_cellular_location _Entity_experimental_src.Host_org_organelle _Entity_experimental_src.Host_org_gene _Entity_experimental_src.Host_org_culture_collection _Entity_experimental_src.Host_org_ATCC_number _Entity_experimental_src.Vector_type _Entity_experimental_src.PDBview_host_org_vector_name _Entity_experimental_src.PDBview_plasmid_name _Entity_experimental_src.Vector_name _Entity_experimental_src.Vector_details _Entity_experimental_src.Vendor_name _Entity_experimental_src.Host_org_dev_stage _Entity_experimental_src.Details _Entity_experimental_src.Citation_ID _Entity_experimental_src.Citation_label _Entity_experimental_src.Entry_ID _Entity_experimental_src.Entity_experimental_src_list_ID 1 1 $lignin_cw_compound_3028 . 'chemical synthesis' . . . . . . . . . . . . . . . . . . . . . . . . . . . . . bmse010352 1 stop_ save_ ################################# # Polymer residues and ligands # ################################# save_chem_comp_1 _Chem_comp.Sf_category chem_comp _Chem_comp.Sf_framecode chem_comp_1 _Chem_comp.Entry_ID bmse010352 _Chem_comp.ID 1 _Chem_comp.Provenance BMRB _Chem_comp.Name lignin_cw_compound_3028 _Chem_comp.Type non-polymer _Chem_comp.BMRB_code ? _Chem_comp.PDB_code ? _Chem_comp.InChI_code InChI=1S/C22H30O7/c1-6-7-14-9-19(27-4)22(20(10-14)28-5)29-16(13-23)8-15-11-17(25-2)21(24)18(12-15)26-3/h9-12,16,23-24H,6-8,13H2,1-5H3/t16-/m0/s1 _Chem_comp.Mon_nstd_flag ? _Chem_comp.Std_deriv_one_letter_code ? _Chem_comp.Std_deriv_three_letter_code ? _Chem_comp.Std_deriv_BMRB_code ? _Chem_comp.Std_deriv_PDB_code ? _Chem_comp.Formal_charge ? _Chem_comp.Paramagnetic no _Chem_comp.Aromatic yes _Chem_comp.Formula 'C22 H30 O7' _Chem_comp.Formula_weight 406.4694 _Chem_comp.Formula_mono_iso_wt_nat 406.1991533177 _Chem_comp.Formula_mono_iso_wt_13C 428.2729597493 _Chem_comp.Formula_mono_iso_wt_15N 406.1991533177 _Chem_comp.Formula_mono_iso_wt_13C_15N 428.2729597493 _Chem_comp.Image_file_name bmse010352.png _Chem_comp.Image_file_format png _Chem_comp.Topo_file_name ? _Chem_comp.Topo_file_format ? _Chem_comp.Struct_file_name bmse010352.mol _Chem_comp.Struct_file_format mol _Chem_comp.Stereochem_param_file_name ? _Chem_comp.Details 'b-O-4 Dimers, 3-Carbon Sidechain' _Chem_comp.DB_query_date ? _Chem_comp.DB_last_query_revised_last_date ? loop_ _Chem_comp_common_name.Name _Chem_comp_common_name.Type _Chem_comp_common_name.Entry_ID _Chem_comp_common_name.Comp_ID 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(2,5-dimethoxy-4-propylphenoxy)propan-1-ol synonym bmse010352 1 stop_ loop_ _Chem_comp_descriptor.Descriptor _Chem_comp_descriptor.Type _Chem_comp_descriptor.Program _Chem_comp_descriptor.Program_version _Chem_comp_descriptor.Entry_ID _Chem_comp_descriptor.Comp_ID ; InChI=1/C22H30O7/c1-6-7-14-9-19(27-4)22(20(10-14)28-5)29-16(13-23)8-15-11-17(25-2)21(24)18(12-15)26-3/h9-12,16,23-24H,6-8,13H2,1-5H3 ; INCHI na na bmse010352 1 InChI=1S/C22H30O7/c1-6-7-14-9-19(27-4)22(20(10-14)28-5)29-16(13-23)8-15-11-17(25-2)21(24)18(12-15)26-3/h9-12,16,23-24H,6-8,13H2,1-5H3/t16-/m0/s1 INCHI ALATIS 3.003 bmse010352 1 stop_ loop_ _Chem_comp_systematic_name.Name _Chem_comp_systematic_name.Naming_system _Chem_comp_systematic_name.Entry_ID _Chem_comp_systematic_name.Comp_ID 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(2,5-dimethoxy-4-propylphenoxy)propan-1-ol Beilstein bmse010352 1 stop_ loop_ _Chem_comp_SMILES.Type _Chem_comp_SMILES.String _Chem_comp_SMILES.Entry_ID _Chem_comp_SMILES.Comp_ID Canonical CCCC1=CC(=C(C(=C1)OC)OC(CC2=CC(=C(C(=C2)OC)O)OC)CO)OC bmse010352 1 Isomeric CCCC1=CC(=C(C(=C1)OC)OC(CC2=CC(=C(C(=C2)OC)O)OC)CO)OC bmse010352 1 stop_ loop_ _Chem_comp_atom.Atom_ID _Chem_comp_atom.Auth_atom_ID _Chem_comp_atom.Type_symbol _Chem_comp_atom.Stereo_config _Chem_comp_atom.Charge _Chem_comp_atom.Oxidation_number _Chem_comp_atom.Unpaired_electron_number _Chem_comp_atom.Drawing_2D_coord_x _Chem_comp_atom.Drawing_2D_coord_y _Chem_comp_atom.Model_Cartn_x _Chem_comp_atom.Model_Cartn_y _Chem_comp_atom.Model_Cartn_z _Chem_comp_atom.PDBX_ordinal _Chem_comp_atom.Entry_ID _Chem_comp_atom.Comp_ID C1 BG C ? ? ? ? 205.7200 22.0000 ? ? ? 1 bmse010352 1 C2 AOMe C ? ? ? ? 399.7072 262.0000 ? ? ? 2 bmse010352 1 C3 AOMe C ? ? ? ? 288.8560 358.0000 ? ? ? 3 bmse010352 1 C4 BOMe C ? ? ? ? 150.2928 150.0000 ? ? ? 4 bmse010352 1 C5 BOMe C ? ? ? ? 316.5712 150.0000 ? ? ? 5 bmse010352 1 C6 BB C ? ? ? ? 205.7200 54.0000 ? ? ? 6 bmse010352 1 C7 ? C ? ? ? ? 233.4320 70.0000 ? ? ? 7 bmse010352 1 C8 BA C ? ? ? ? 261.1440 246.0000 ? ? ? 8 bmse010352 1 C9 B2 C ? ? ? ? 205.7200 118.0000 ? ? ? 9 bmse010352 1 C10 B6 C ? ? ? ? 261.1440 118.0000 ? ? ? 10 bmse010352 1 C11 A2 C ? ? ? ? 316.5712 246.0000 ? ? ? 11 bmse010352 1 C12 A6 C ? ? ? ? 288.8560 294.0000 ? ? ? 12 bmse010352 1 C13 G C ? ? ? ? 288.8560 198.0000 ? ? ? 13 bmse010352 1 C14 B1 C ? ? ? ? 233.4320 102.0000 ? ? ? 14 bmse010352 1 C15 A1 C ? ? ? ? 288.8560 262.0000 ? ? ? 15 bmse010352 1 C16 B C ? ? ? ? 261.1440 214.0000 ? ? ? 16 bmse010352 1 C17 A3 C ? ? ? ? 344.2832 262.0000 ? ? ? 17 bmse010352 1 C18 A5 C ? ? ? ? 316.5712 310.0000 ? ? ? 18 bmse010352 1 C19 B3 C ? ? ? ? 205.7200 150.0000 ? ? ? 19 bmse010352 1 C20 B5 C ? ? ? ? 261.1440 150.0000 ? ? ? 20 bmse010352 1 C21 A4 C ? ? ? ? 344.2832 294.0000 ? ? ? 21 bmse010352 1 C22 B4 C ? ? ? ? 233.4320 166.0000 ? ? ? 22 bmse010352 1 O23 ? O ? ? ? ? 316.5712 214.0000 ? ? ? 23 bmse010352 1 O24 ? O ? ? ? ? 371.9952 310.0000 ? ? ? 24 bmse010352 1 O25 ? O ? ? ? ? 371.9952 246.0000 ? ? ? 25 bmse010352 1 O26 ? O ? ? ? ? 316.5712 342.0000 ? ? ? 26 bmse010352 1 O27 ? O ? ? ? ? 178.0048 166.0000 ? ? ? 27 bmse010352 1 O28 ? O ? ? ? ? 288.8560 166.0000 ? ? ? 28 bmse010352 1 O29 ? O ? ? ? ? 233.4320 198.0000 ? ? ? 29 bmse010352 1 H31 BG H ? ? ? ? 185.8800 22.0000 ? ? ? 30 bmse010352 1 H30 BG H ? ? ? ? 205.7200 2.1600 ? ? ? 31 bmse010352 1 H32 BG H ? ? ? ? 225.5600 22.0000 ? ? ? 32 bmse010352 1 H33 AOMe H ? ? ? ? 409.6274 244.8182 ? ? ? 33 bmse010352 1 H35 AOMe H ? ? ? ? 416.8890 271.9202 ? ? ? 34 bmse010352 1 H34 AOMe H ? ? ? ? 389.7870 279.1818 ? ? ? 35 bmse010352 1 H36 AOMe H ? ? ? ? 298.7753 375.1823 ? ? ? 36 bmse010352 1 H37 AOMe H ? ? ? ? 271.6737 367.9193 ? ? ? 37 bmse010352 1 H38 AOMe H ? ? ? ? 278.9366 340.8177 ? ? ? 38 bmse010352 1 H39 BOMe H ? ? ? ? 140.3726 167.1818 ? ? ? 39 bmse010352 1 H41 BOMe H ? ? ? ? 133.1110 140.0798 ? ? ? 40 bmse010352 1 H40 BOMe H ? ? ? ? 160.2130 132.8182 ? ? ? 41 bmse010352 1 H43 BOMe H ? ? ? ? 306.6519 132.8177 ? ? ? 42 bmse010352 1 H42 BOMe H ? ? ? ? 333.7535 140.0806 ? ? ? 43 bmse010352 1 H44 BOMe H ? ? ? ? 326.4905 167.1823 ? ? ? 44 bmse010352 1 H45 BB H ? ? ? ? 198.9342 72.6434 ? ? ? 45 bmse010352 1 H46 BB H ? ? ? ? 186.1814 50.5547 ? ? ? 46 bmse010352 1 H47 BA H ? ? ? ? 240.2178 51.3566 ? ? ? 47 bmse010352 1 H48 BA H ? ? ? ? 252.9706 73.4453 ? ? ? 48 bmse010352 1 H49 A1 H ? ? ? ? 254.3582 264.6434 ? ? ? 49 bmse010352 1 H50 A2 H ? ? ? ? 241.6054 242.5547 ? ? ? 50 bmse010352 1 H51 B2 H ? ? ? ? 188.5380 108.0801 ? ? ? 51 bmse010352 1 H52 B6 H ? ? ? ? 278.3260 108.0801 ? ? ? 52 bmse010352 1 H53 A2 H ? ? ? ? 316.5717 226.1600 ? ? ? 53 bmse010352 1 H54 A6 H ? ? ? ? 271.6742 303.9203 ? ? ? 54 bmse010352 1 H55 G1 H ? ? ? ? 276.1028 182.8020 ? ? ? 55 bmse010352 1 H56 G2 H ? ? ? ? 301.6085 182.8013 ? ? ? 56 bmse010352 1 H57 B H ? ? ? ? 243.9620 223.9199 ? ? ? 57 bmse010352 1 H58 GOH H ? ? ? ? 333.7528 204.0794 ? ? ? 58 bmse010352 1 H59 ArOH H ? ? ? ? 389.1773 300.0802 ? ? ? 59 bmse010352 1 stop_ loop_ _Atom_nomenclature.Atom_ID _Atom_nomenclature.Atom_name _Atom_nomenclature.Naming_system _Atom_nomenclature.Entry_ID _Atom_nomenclature.Comp_ID C1 C1 BMRB bmse010352 1 C2 C2 BMRB bmse010352 1 C3 C3 BMRB bmse010352 1 C4 C4 BMRB bmse010352 1 C5 C5 BMRB bmse010352 1 C6 C6 BMRB bmse010352 1 C7 C7 BMRB bmse010352 1 C8 C8 BMRB bmse010352 1 C9 C9 BMRB bmse010352 1 C10 C10 BMRB bmse010352 1 C11 C11 BMRB bmse010352 1 C12 C12 BMRB bmse010352 1 C13 C13 BMRB bmse010352 1 C14 C14 BMRB bmse010352 1 C15 C15 BMRB bmse010352 1 C16 C16 BMRB bmse010352 1 C17 C17 BMRB bmse010352 1 C18 C18 BMRB bmse010352 1 C19 C19 BMRB bmse010352 1 C20 C20 BMRB bmse010352 1 C21 C21 BMRB bmse010352 1 C22 C22 BMRB bmse010352 1 O23 O23 BMRB bmse010352 1 O24 O24 BMRB bmse010352 1 O25 O25 BMRB bmse010352 1 O26 O26 BMRB bmse010352 1 O27 O27 BMRB bmse010352 1 O28 O28 BMRB bmse010352 1 O29 O29 BMRB bmse010352 1 H31 H30 BMRB bmse010352 1 H30 H31 BMRB bmse010352 1 H32 H32 BMRB bmse010352 1 H33 H33 BMRB bmse010352 1 H35 H34 BMRB bmse010352 1 H34 H35 BMRB bmse010352 1 H36 H36 BMRB bmse010352 1 H37 H37 BMRB bmse010352 1 H38 H38 BMRB bmse010352 1 H39 H39 BMRB bmse010352 1 H41 H40 BMRB bmse010352 1 H40 H41 BMRB bmse010352 1 H43 H42 BMRB bmse010352 1 H42 H43 BMRB bmse010352 1 H44 H44 BMRB bmse010352 1 H45 H45 BMRB bmse010352 1 H46 H46 BMRB bmse010352 1 H47 H47 BMRB bmse010352 1 H48 H48 BMRB bmse010352 1 H49 H49 BMRB bmse010352 1 H50 H50 BMRB bmse010352 1 H51 H51 BMRB bmse010352 1 H52 H52 BMRB bmse010352 1 H53 H53 BMRB bmse010352 1 H54 H54 BMRB bmse010352 1 H55 H55 BMRB bmse010352 1 H56 H56 BMRB bmse010352 1 H57 H57 BMRB bmse010352 1 H58 H58 BMRB bmse010352 1 H59 H59 BMRB bmse010352 1 C1 C1 ALATIS bmse010352 1 C2 C2 ALATIS bmse010352 1 C3 C3 ALATIS bmse010352 1 C4 C4 ALATIS bmse010352 1 C5 C5 ALATIS bmse010352 1 C6 C6 ALATIS bmse010352 1 C7 C7 ALATIS bmse010352 1 C8 C8 ALATIS bmse010352 1 C9 C9 ALATIS bmse010352 1 C10 C10 ALATIS bmse010352 1 C11 C11 ALATIS bmse010352 1 C12 C12 ALATIS bmse010352 1 C13 C13 ALATIS bmse010352 1 C14 C14 ALATIS bmse010352 1 C15 C15 ALATIS bmse010352 1 C16 C16 ALATIS bmse010352 1 C17 C17 ALATIS bmse010352 1 C18 C18 ALATIS bmse010352 1 C19 C19 ALATIS bmse010352 1 C20 C20 ALATIS bmse010352 1 C21 C21 ALATIS bmse010352 1 C22 C22 ALATIS bmse010352 1 O23 O23 ALATIS bmse010352 1 O24 O24 ALATIS bmse010352 1 O25 O25 ALATIS bmse010352 1 O26 O26 ALATIS bmse010352 1 O27 O27 ALATIS bmse010352 1 O28 O28 ALATIS bmse010352 1 O29 O29 ALATIS bmse010352 1 H31 H31 ALATIS bmse010352 1 H30 H30 ALATIS bmse010352 1 H32 H32 ALATIS bmse010352 1 H33 H33 ALATIS bmse010352 1 H35 H35 ALATIS bmse010352 1 H34 H34 ALATIS bmse010352 1 H36 H36 ALATIS bmse010352 1 H37 H37 ALATIS bmse010352 1 H38 H38 ALATIS bmse010352 1 H39 H39 ALATIS bmse010352 1 H41 H41 ALATIS bmse010352 1 H40 H40 ALATIS bmse010352 1 H43 H43 ALATIS bmse010352 1 H42 H42 ALATIS bmse010352 1 H44 H44 ALATIS bmse010352 1 H45 H45 ALATIS bmse010352 1 H46 H46 ALATIS bmse010352 1 H47 H47 ALATIS bmse010352 1 H48 H48 ALATIS bmse010352 1 H49 H49 ALATIS bmse010352 1 H50 H50 ALATIS bmse010352 1 H51 H51 ALATIS bmse010352 1 H52 H52 ALATIS bmse010352 1 H53 H53 ALATIS bmse010352 1 H54 H54 ALATIS bmse010352 1 H55 H55 ALATIS bmse010352 1 H56 H56 ALATIS bmse010352 1 H57 H57 ALATIS bmse010352 1 H58 H58 ALATIS bmse010352 1 H59 H59 ALATIS bmse010352 1 stop_ loop_ _Chem_comp_bond.ID _Chem_comp_bond.Type _Chem_comp_bond.Value_order _Chem_comp_bond.Atom_ID_1 _Chem_comp_bond.Atom_ID_2 _Chem_comp_bond.Details _Chem_comp_bond.Entry_ID _Chem_comp_bond.Comp_ID 1 covalent SING C1 C6 ? bmse010352 1 2 covalent SING C2 O25 ? bmse010352 1 3 covalent SING C3 O26 ? bmse010352 1 4 covalent SING C4 O27 ? bmse010352 1 5 covalent SING C5 O28 ? bmse010352 1 6 covalent SING C6 C7 ? bmse010352 1 7 covalent SING C7 C14 ? bmse010352 1 8 covalent SING C8 C15 ? bmse010352 1 9 covalent SING C8 C16 ? bmse010352 1 10 covalent DOUB C9 C14 ? bmse010352 1 11 covalent SING C9 C19 ? bmse010352 1 12 covalent SING C10 C14 ? bmse010352 1 13 covalent DOUB C10 C20 ? bmse010352 1 14 covalent DOUB C11 C15 ? bmse010352 1 15 covalent SING C11 C17 ? bmse010352 1 16 covalent SING C12 C15 ? bmse010352 1 17 covalent DOUB C12 C18 ? bmse010352 1 18 covalent SING C13 C16 ? bmse010352 1 19 covalent SING C13 O23 ? bmse010352 1 20 covalent SING C16 O29 ? bmse010352 1 21 covalent DOUB C17 C21 ? bmse010352 1 22 covalent SING C17 O25 ? bmse010352 1 23 covalent SING C18 C21 ? bmse010352 1 24 covalent SING C18 O26 ? bmse010352 1 25 covalent DOUB C19 C22 ? bmse010352 1 26 covalent SING C19 O27 ? bmse010352 1 27 covalent SING C20 C22 ? bmse010352 1 28 covalent SING C20 O28 ? bmse010352 1 29 covalent SING C21 O24 ? bmse010352 1 30 covalent SING C22 O29 ? bmse010352 1 31 covalent SING C1 H31 ? bmse010352 1 32 covalent SING C1 H30 ? bmse010352 1 33 covalent SING C1 H32 ? bmse010352 1 34 covalent SING C2 H33 ? bmse010352 1 35 covalent SING C2 H35 ? bmse010352 1 36 covalent SING C2 H34 ? bmse010352 1 37 covalent SING C3 H36 ? bmse010352 1 38 covalent SING C3 H37 ? bmse010352 1 39 covalent SING C3 H38 ? bmse010352 1 40 covalent SING C4 H39 ? bmse010352 1 41 covalent SING C4 H41 ? bmse010352 1 42 covalent SING C4 H40 ? bmse010352 1 43 covalent SING C5 H43 ? bmse010352 1 44 covalent SING C5 H42 ? bmse010352 1 45 covalent SING C5 H44 ? bmse010352 1 46 covalent SING C6 H45 ? bmse010352 1 47 covalent SING C6 H46 ? bmse010352 1 48 covalent SING C7 H47 ? bmse010352 1 49 covalent SING C7 H48 ? bmse010352 1 50 covalent SING C8 H49 ? bmse010352 1 51 covalent SING C8 H50 ? bmse010352 1 52 covalent SING C9 H51 ? bmse010352 1 53 covalent SING C10 H52 ? bmse010352 1 54 covalent SING C11 H53 ? bmse010352 1 55 covalent SING C12 H54 ? bmse010352 1 56 covalent SING C13 H55 ? bmse010352 1 57 covalent SING C13 H56 ? bmse010352 1 58 covalent SING C16 H57 ? bmse010352 1 59 covalent SING O23 H58 ? bmse010352 1 60 covalent SING O24 H59 ? bmse010352 1 stop_ loop_ _Chem_comp_db_link.Author_supplied _Chem_comp_db_link.Database_code _Chem_comp_db_link.Accession_code _Chem_comp_db_link.Accession_code_type _Chem_comp_db_link.Entry_mol_code _Chem_comp_db_link.Entry_mol_name _Chem_comp_db_link.Entry_experimental_method _Chem_comp_db_link.Entry_relation_type _Chem_comp_db_link.Entry_details _Chem_comp_db_link.Entry_ID _Chem_comp_db_link.Comp_ID yes USDA_NMR_database 3028 'Compound Number' ? lignin_cw_compound_3028 ? 'matching entry' ? bmse010352 1 stop_ loop_ _Chem_comp_citation.Citation_ID _Chem_comp_citation.Citation_label _Chem_comp_citation.Entry_ID _Chem_comp_citation.Comp_ID 1 $citation_1 bmse010352 1 stop_ save_ ##################################### # Sample contents and methodology # ##################################### ######################## # Sample description # ######################## save_sample_1 _Sample.Sf_category sample _Sample.Sf_framecode sample_1 _Sample.Entry_ID bmse010352 _Sample.ID 1 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_3028 'natural abundance' 1 $lignin_cw_compound_3028 ? Solute Saturated ? ? 1 ? 'Sally Ralph' 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(2,5-dimethoxy-4-propylphenoxy)propan-1-ol n/a bmse010352 1 2 CDCl3 ? 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010352 1 stop_ save_ ##################################### # Sample contents and methodology # ##################################### ######################## # Sample description # ######################## save_sample_2 _Sample.Sf_category sample _Sample.Sf_framecode sample_2 _Sample.Entry_ID bmse010352 _Sample.ID 2 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_3028 'natural abundance' 1 $lignin_cw_compound_3028 ? Solute Saturated ? ? 1 ? 'Sally Ralph' 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(2,5-dimethoxy-4-propylphenoxy)propan-1-ol n/a bmse010352 2 2 acetone '100% deuterated' 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010352 2 stop_ save_ ##################################### # Sample contents and methodology # ##################################### ######################## # Sample description # ######################## save_sample_3 _Sample.Sf_category sample _Sample.Sf_framecode sample_3 _Sample.Entry_ID bmse010352 _Sample.ID 3 _Sample.Type solution loop_ _Sample_component.ID _Sample_component.Mol_common_name _Sample_component.Isotopic_labeling _Sample_component.Entity_ID _Sample_component.Entity_label _Sample_component.Product_ID _Sample_component.Type _Sample_component.Concentration_val _Sample_component.Concentration_val_min _Sample_component.Concentration_val_max _Sample_component.Concentration_val_units _Sample_component.Concentration_val_err _Sample_component.Vendor _Sample_component.Vendor_product_name _Sample_component.Vendor_product_code _Sample_component.Entry_ID _Sample_component.Sample_ID 1 lignin_cw_compound_3028 'natural abundance' 1 $lignin_cw_compound_3028 ? Solute Saturated ? ? 1 ? 'Sally Ralph' 3-(4-hydroxy-3,5-dimethoxyphenyl)-2-(2,5-dimethoxy-4-propylphenoxy)propan-1-ol n/a bmse010352 3 2 DMSO '100% deuterated' 1 ? ? Solvent 100 ? ? % ? ? ? ? bmse010352 3 stop_ save_ ####################### # Sample conditions # ####################### save_sample_conditions_1 _Sample_condition_list.Sf_category sample_conditions _Sample_condition_list.Sf_framecode sample_conditions_1 _Sample_condition_list.Entry_ID bmse010352 _Sample_condition_list.ID 1 loop_ _Sample_condition_variable.Type _Sample_condition_variable.Val _Sample_condition_variable.Val_err _Sample_condition_variable.Val_units _Sample_condition_variable.Entry_ID _Sample_condition_variable.Sample_condition_list_ID pH n/a ? pH bmse010352 1 temperature 297 ? K bmse010352 1 stop_ save_ ############################ # Computer software used # ############################ save_software_1 _Software.Sf_category software _Software.Sf_framecode software_1 _Software.Entry_ID bmse010352 _Software.ID 1 _Software.Name X-WINNMR _Software.Version ? _Software.Details ? loop_ _Vendor.Name _Vendor.Address _Vendor.Electronic_address _Vendor.Entry_ID _Vendor.Software_ID Bruker ? ? bmse010352 1 stop_ loop_ _Task.Task _Task.Entry_ID _Task.Software_ID Processing bmse010352 1 stop_ save_ ######################### # Experimental detail # ######################### ################################## # NMR Spectrometer definitions # ################################## save_Bruker_360 _NMR_spectrometer.Sf_category NMR_spectrometer _NMR_spectrometer.Sf_framecode Bruker_360 _NMR_spectrometer.Entry_ID bmse010352 _NMR_spectrometer.ID 1 _NMR_spectrometer.Manufacturer Bruker _NMR_spectrometer.Model DRX _NMR_spectrometer.Field_strength 360 save_ ############################# # NMR applied experiments # ############################# save_experiment_list _Experiment_list.Sf_category experiment_list _Experiment_list.Sf_framecode experiment_list _Experiment_list.Entry_ID bmse010352 _Experiment_list.ID 1 _Experiment_list.Details ? loop_ _Experiment.ID _Experiment.Name _Experiment.Raw_data_flag _Experiment.NMR_spec_expt_ID _Experiment.NMR_spec_expt_label _Experiment.Sample_ID _Experiment.Sample_label _Experiment.Sample_state _Experiment.Sample_condition_list_ID _Experiment.Sample_condition_list_label _Experiment.NMR_spectrometer_ID _Experiment.NMR_spectrometer_label _Experiment.NMR_spectral_processing_ID _Experiment.NMR_spectral_processing_label _Experiment.Entry_ID _Experiment.Experiment_list_ID 1 '1D 1H' no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010352 1 2 '1D 13C' no ? ? 1 $sample_1 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010352 1 3 '1D 1H' no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010352 1 4 '1D 13C' no ? ? 2 $sample_2 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010352 1 5 '1D 1H' no ? ? 3 $sample_3 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010352 1 6 '1D 13C' no ? ? 3 $sample_3 isotropic 1 $sample_conditions_1 1 $Bruker_360 ? ? bmse010352 1 stop_ save_ #################### # NMR parameters # #################### ############################## # Assigned chemical shifts # ############################## ################################ # Chemical shift referencing # ################################ save_chem_shift_reference_1 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_1 _Chem_shift_reference.Entry_ID bmse010352 _Chem_shift_reference.ID 1 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 CDCl3 'residual solvent proton' ppm 7.24 internal direct 1.000000000 ? ? ? bmse010352 1 C 13 CDCl3 'solvent carbon' ppm 77.00 internal direct ? ? ? ? bmse010352 1 stop_ save_ #################### # NMR parameters # #################### ############################## # Assigned chemical shifts # ############################## ################################ # Chemical shift referencing # ################################ save_chem_shift_reference_2 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_2 _Chem_shift_reference.Entry_ID bmse010352 _Chem_shift_reference.ID 2 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 Acetone-d6 'residual solvent methyl proton' ppm 2.04 internal direct 1.000000000 ? ? ? bmse010352 2 C 13 Acetone-d6 'solvent methyl carbon' ppm 29.83 internal direct ? ? ? ? bmse010352 2 stop_ save_ #################### # NMR parameters # #################### ############################## # Assigned chemical shifts # ############################## ################################ # Chemical shift referencing # ################################ save_chem_shift_reference_3 _Chem_shift_reference.Sf_category chem_shift_reference _Chem_shift_reference.Sf_framecode chem_shift_reference_3 _Chem_shift_reference.Entry_ID bmse010352 _Chem_shift_reference.ID 3 _Chem_shift_reference.Details ? loop_ _Chem_shift_ref.Atom_type _Chem_shift_ref.Atom_isotope_number _Chem_shift_ref.Mol_common_name _Chem_shift_ref.Atom_group _Chem_shift_ref.Chem_shift_units _Chem_shift_ref.Chem_shift_val _Chem_shift_ref.Ref_method _Chem_shift_ref.Ref_type _Chem_shift_ref.Indirect_shift_ratio _Chem_shift_ref.External_ref_loc _Chem_shift_ref.External_ref_sample_geometry _Chem_shift_ref.External_ref_axis _Chem_shift_ref.Entry_ID _Chem_shift_ref.Chem_shift_reference_ID H 1 DMSO-d6 'residual solvent methyl proton' ppm 2.49 internal direct 1.000000000 ? ? ? bmse010352 3 C 13 DMSO-d6 'solvent methyl carbon' ppm 39.50 internal direct ? ? ? ? bmse010352 3 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # The values other than 1 are used for those atoms with different # # chemical shifts that cannot be assigned to stereospecific atoms # # or to specific residues or chains. # # # # Index Value Definition # # # # 1 Unique (including isolated methyl protons, # # geminal atoms, and geminal methyl # # groups with identical chemical shifts) # # (e.g. ILE HD11, HD12, HD13 protons) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups (e.g. ASP HB2 and HB3 # # protons, LEU CD1 and CD2 carbons, or # # LEU HD11, HD12, HD13 and HD21, HD22, # # HD23 methyl protons) # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. TYR HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. LYS HG and # # HD protons or TRP HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (LYS 12 vs. LYS 27) # # 6 Intermolecular ambiguities (e.g. ASP 31 CA # # in monomer 1 and ASP 31 CA in monomer 2 # # of an asymmetrical homodimer, duplex # # DNA assignments, or other assignments # # that may apply to atoms in one or more # # molecule in the molecular assembly) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_1 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_1 _Assigned_chem_shift_list.Entry_ID bmse010352 _Assigned_chem_shift_list.ID 1 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 1 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_1 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 1 '1D 1H' 1 $sample_1 bmse010352 1 2 '1D 13C' 1 $sample_1 bmse010352 1 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010352 1 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C1 C 13 13.70 ? ? 1 ? ? ? ? ? BG ? bmse010352 1 2 ? 1 1 1 1 1 C6 C 13 24.47 ? ? 1 ? ? ? ? ? BB ? bmse010352 1 3 ? 1 1 1 1 1 C9 C 13 37.65 ? ? 1 ? ? ? ? ? A ? bmse010352 1 4 ? 1 1 1 1 1 C8 C 13 38.24 ? ? 1 ? ? ? ? ? BA ? bmse010352 1 5 ? 1 1 1 1 1 C2 C 13 55.96 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 1 6 ? 1 1 1 1 1 C3 C 13 55.96 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 1 7 ? 1 1 1 1 1 C4 C 13 56.19 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 1 8 ? 1 1 1 1 1 C5 C 13 56.19 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 1 9 ? 1 1 1 1 1 C13 C 13 62.19 ? ? 1 ? ? ? ? ? G ? bmse010352 1 10 ? 1 1 1 1 1 C16 C 13 84.19 ? ? 1 ? ? ? ? ? B ? bmse010352 1 11 ? 1 1 1 1 1 C9 C 13 105.42 ? ? 1 ? ? ? ? ? B2 ? bmse010352 1 12 ? 1 1 1 1 1 C10 C 13 105.42 ? ? 1 ? ? ? ? ? B6 ? bmse010352 1 13 ? 1 1 1 1 1 C11 C 13 106.12 ? ? 1 ? ? ? ? ? A2 ? bmse010352 1 14 ? 1 1 1 1 1 C12 C 13 106.12 ? ? 1 ? ? ? ? ? A6 ? bmse010352 1 15 ? 1 1 1 1 1 C15 C 13 129.21 ? ? 1 ? ? ? ? ? A1 ? bmse010352 1 16 ? 1 1 1 1 1 C22 C 13 133.07 ? ? 1 ? ? ? ? ? B4 ? bmse010352 1 17 ? 1 1 1 1 1 C21 C 13 133.28 ? ? 1 ? ? ? ? ? A4 ? bmse010352 1 18 ? 1 1 1 1 1 C14 C 13 138.64 ? ? 1 ? ? ? ? ? B1 ? bmse010352 1 19 ? 1 1 1 1 1 C17 C 13 146.75 ? ? 1 ? ? ? ? ? A3 ? bmse010352 1 20 ? 1 1 1 1 1 C18 C 13 146.75 ? ? 1 ? ? ? ? ? A5 ? bmse010352 1 21 ? 1 1 1 1 1 C19 C 13 152.92 ? ? 1 ? ? ? ? ? B3 ? bmse010352 1 22 ? 1 1 1 1 1 C20 C 13 152.92 ? ? 1 ? ? ? ? ? B5 ? bmse010352 1 23 ? 1 1 1 1 1 H31 H 1 0.917 ? ? 1 ? ? ? ? ? BG ? bmse010352 1 24 ? 1 1 1 1 1 H30 H 1 0.917 ? ? 1 ? ? ? ? ? BG ? bmse010352 1 25 ? 1 1 1 1 1 H32 H 1 0.917 ? ? 1 ? ? ? ? ? BG ? bmse010352 1 26 ? 1 1 1 1 1 H45 H 1 1.592 ? ? 1 ? ? ? ? ? BB ? bmse010352 1 27 ? 1 1 1 1 1 H46 H 1 1.592 ? ? 1 ? ? ? ? ? BB ? bmse010352 1 28 ? 1 1 1 1 1 H47 H 1 2.489 ? ? 1 ? ? ? ? ? BA ? bmse010352 1 29 ? 1 1 1 1 1 H48 H 1 2.489 ? ? 1 ? ? ? ? ? BA ? bmse010352 1 30 ? 1 1 1 1 1 H49 H 1 2.950 ? ? 1 ? ? ? ? ? A1 ? bmse010352 1 31 ? 1 1 1 1 1 H50 H 1 3.175 ? ? 1 ? ? ? ? ? A2 ? bmse010352 1 32 ? 1 1 1 1 1 H55 H 1 3.408 ? ? 1 ? ? ? ? ? G1 ? bmse010352 1 33 ? 1 1 1 1 1 H56 H 1 3.542 ? ? 1 ? ? ? ? ? G2 ? bmse010352 1 34 ? 1 1 1 1 1 H58 H 1 3.47 ? ? 1 ? ? ? ? ? GOH ? bmse010352 1 35 ? 1 1 1 1 1 H33 H 1 3.798 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 1 36 ? 1 1 1 1 1 H35 H 1 3.798 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 1 37 ? 1 1 1 1 1 H34 H 1 3.798 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 1 38 ? 1 1 1 1 1 H36 H 1 3.798 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 1 39 ? 1 1 1 1 1 H37 H 1 3.798 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 1 40 ? 1 1 1 1 1 H38 H 1 3.798 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 1 41 ? 1 1 1 1 1 H39 H 1 3.829 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 1 42 ? 1 1 1 1 1 H41 H 1 3.829 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 1 43 ? 1 1 1 1 1 H40 H 1 3.829 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 1 44 ? 1 1 1 1 1 H43 H 1 3.829 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 1 45 ? 1 1 1 1 1 H42 H 1 3.829 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 1 46 ? 1 1 1 1 1 H44 H 1 3.829 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 1 47 ? 1 1 1 1 1 H57 H 1 4.152 ? ? 1 ? ? ? ? ? B ? bmse010352 1 48 ? 1 1 1 1 1 H51 H 1 6.386 ? ? 1 ? ? ? ? ? B2 ? bmse010352 1 49 ? 1 1 1 1 1 H52 H 1 6.386 ? ? 1 ? ? ? ? ? B6 ? bmse010352 1 50 ? 1 1 1 1 1 H53 H 1 6.498 ? ? 1 ? ? ? ? ? A2 ? bmse010352 1 51 ? 1 1 1 1 1 H54 H 1 6.498 ? ? 1 ? ? ? ? ? A6 ? bmse010352 1 52 ? 1 1 1 1 1 H59 H 1 5.493 ? ? 1 ? ? ? ? ? ArOH ? bmse010352 1 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # The values other than 1 are used for those atoms with different # # chemical shifts that cannot be assigned to stereospecific atoms # # or to specific residues or chains. # # # # Index Value Definition # # # # 1 Unique (including isolated methyl protons, # # geminal atoms, and geminal methyl # # groups with identical chemical shifts) # # (e.g. ILE HD11, HD12, HD13 protons) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups (e.g. ASP HB2 and HB3 # # protons, LEU CD1 and CD2 carbons, or # # LEU HD11, HD12, HD13 and HD21, HD22, # # HD23 methyl protons) # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. TYR HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. LYS HG and # # HD protons or TRP HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (LYS 12 vs. LYS 27) # # 6 Intermolecular ambiguities (e.g. ASP 31 CA # # in monomer 1 and ASP 31 CA in monomer 2 # # of an asymmetrical homodimer, duplex # # DNA assignments, or other assignments # # that may apply to atoms in one or more # # molecule in the molecular assembly) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_2 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_2 _Assigned_chem_shift_list.Entry_ID bmse010352 _Assigned_chem_shift_list.ID 2 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 2 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_2 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 3 '1D 1H' 2 $sample_2 bmse010352 2 4 '1D 13C' 2 $sample_2 bmse010352 2 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010352 2 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C1 C 13 14.06 ? ? 1 ? ? ? ? ? BG ? bmse010352 2 2 ? 1 1 1 1 1 C6 C 13 25.30 ? ? 1 ? ? ? ? ? BB ? bmse010352 2 3 ? 1 1 1 1 1 C9 C 13 38.38 ? ? 1 ? ? ? ? ? A ? bmse010352 2 4 ? 1 1 1 1 1 C8 C 13 38.80 ? ? 1 ? ? ? ? ? BA ? bmse010352 2 5 ? 1 1 1 1 1 C2 C 13 56.43 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 2 6 ? 1 1 1 1 1 C3 C 13 56.43 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 2 7 ? 1 1 1 1 1 C4 C 13 56.58 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 2 8 ? 1 1 1 1 1 C5 C 13 56.58 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 2 9 ? 1 1 1 1 1 C13 C 13 62.93 ? ? 1 ? ? ? ? ? G ? bmse010352 2 10 ? 1 1 1 1 1 C16 C 13 85.20 ? ? 1 ? ? ? ? ? B ? bmse010352 2 11 ? 1 1 1 1 1 C9 C 13 106.57 ? ? 1 ? ? ? ? ? B2 ? bmse010352 2 12 ? 1 1 1 1 1 C10 C 13 106.57 ? ? 1 ? ? ? ? ? B6 ? bmse010352 2 13 ? 1 1 1 1 1 C11 C 13 107.83 ? ? 1 ? ? ? ? ? A2 ? bmse010352 2 14 ? 1 1 1 1 1 C12 C 13 107.83 ? ? 1 ? ? ? ? ? A6 ? bmse010352 2 15 ? 1 1 1 1 1 C15 C 13 129.69 ? ? 1 ? ? ? ? ? A1 ? bmse010352 2 16 ? 1 1 1 1 1 C22 C 13 134.94 ? ? 1 ? ? ? ? ? B4 ? bmse010352 2 17 ? 1 1 1 1 1 C21 C 13 135.24 ? ? 1 ? ? ? ? ? A4 ? bmse010352 2 18 ? 1 1 1 1 1 C14 C 13 139.10 ? ? 1 ? ? ? ? ? B1 ? bmse010352 2 19 ? 1 1 1 1 1 C17 C 13 148.44 ? ? 1 ? ? ? ? ? A3 ? bmse010352 2 20 ? 1 1 1 1 1 C18 C 13 148.44 ? ? 1 ? ? ? ? ? A5 ? bmse010352 2 21 ? 1 1 1 1 1 C19 C 13 154.07 ? ? 1 ? ? ? ? ? B3 ? bmse010352 2 22 ? 1 1 1 1 1 C20 C 13 154.07 ? ? 1 ? ? ? ? ? B5 ? bmse010352 2 23 ? 1 1 1 1 1 H31 H 1 0.917 ? ? 1 ? ? ? ? ? BG ? bmse010352 2 24 ? 1 1 1 1 1 H30 H 1 0.917 ? ? 1 ? ? ? ? ? BG ? bmse010352 2 25 ? 1 1 1 1 1 H32 H 1 0.917 ? ? 1 ? ? ? ? ? BG ? bmse010352 2 26 ? 1 1 1 1 1 H45 H 1 1.620 ? ? 1 ? ? ? ? ? BB ? bmse010352 2 27 ? 1 1 1 1 1 H46 H 1 1.620 ? ? 1 ? ? ? ? ? BB ? bmse010352 2 28 ? 1 1 1 1 1 H47 H 1 2.525 ? ? 1 ? ? ? ? ? BA ? bmse010352 2 29 ? 1 1 1 1 1 H48 H 1 2.525 ? ? 1 ? ? ? ? ? BA ? bmse010352 2 30 ? 1 1 1 1 1 H49 H 1 2.925 ? ? 1 ? ? ? ? ? A1 ? bmse010352 2 31 ? 1 1 1 1 1 H50 H 1 3.074 ? ? 1 ? ? ? ? ? A2 ? bmse010352 2 32 ? 1 1 1 1 1 H55 H 1 3.402 ? ? 1 ? ? ? ? ? G1 ? bmse010352 2 33 ? 1 1 1 1 1 H56 H 1 3.486 ? ? 1 ? ? ? ? ? G2 ? bmse010352 2 34 ? 1 1 1 1 1 H58 H 1 3.47 ? ? 1 ? ? ? ? ? GOH ? bmse010352 2 35 ? 1 1 1 1 1 H33 H 1 3.793 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 2 36 ? 1 1 1 1 1 H35 H 1 3.793 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 2 37 ? 1 1 1 1 1 H34 H 1 3.793 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 2 38 ? 1 1 1 1 1 H36 H 1 3.793 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 2 39 ? 1 1 1 1 1 H37 H 1 3.793 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 2 40 ? 1 1 1 1 1 H38 H 1 3.793 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 2 41 ? 1 1 1 1 1 H39 H 1 3.825 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 2 42 ? 1 1 1 1 1 H41 H 1 3.825 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 2 43 ? 1 1 1 1 1 H40 H 1 3.825 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 2 44 ? 1 1 1 1 1 H43 H 1 3.825 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 2 45 ? 1 1 1 1 1 H42 H 1 3.825 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 2 46 ? 1 1 1 1 1 H44 H 1 3.825 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 2 47 ? 1 1 1 1 1 H57 H 1 4.142 ? ? 1 ? ? ? ? ? B ? bmse010352 2 48 ? 1 1 1 1 1 H51 H 1 6.544 ? ? 1 ? ? ? ? ? B2 ? bmse010352 2 49 ? 1 1 1 1 1 H52 H 1 6.544 ? ? 1 ? ? ? ? ? B6 ? bmse010352 2 50 ? 1 1 1 1 1 H53 H 1 6.573 ? ? 1 ? ? ? ? ? A2 ? bmse010352 2 51 ? 1 1 1 1 1 H54 H 1 6.573 ? ? 1 ? ? ? ? ? A6 ? bmse010352 2 52 ? 1 1 1 1 1 H59 H 1 6.949 ? ? 1 ? ? ? ? ? ArOH ? bmse010352 2 stop_ save_ ################################### # Assigned chemical shift lists # ################################### ################################################################### # Chemical Shift Ambiguity Index Value Definitions # # # # The values other than 1 are used for those atoms with different # # chemical shifts that cannot be assigned to stereospecific atoms # # or to specific residues or chains. # # # # Index Value Definition # # # # 1 Unique (including isolated methyl protons, # # geminal atoms, and geminal methyl # # groups with identical chemical shifts) # # (e.g. ILE HD11, HD12, HD13 protons) # # 2 Ambiguity of geminal atoms or geminal methyl # # proton groups (e.g. ASP HB2 and HB3 # # protons, LEU CD1 and CD2 carbons, or # # LEU HD11, HD12, HD13 and HD21, HD22, # # HD23 methyl protons) # # 3 Aromatic atoms on opposite sides of # # symmetrical rings (e.g. TYR HE1 and HE2 # # protons) # # 4 Intraresidue ambiguities (e.g. LYS HG and # # HD protons or TRP HZ2 and HZ3 protons) # # 5 Interresidue ambiguities (LYS 12 vs. LYS 27) # # 6 Intermolecular ambiguities (e.g. ASP 31 CA # # in monomer 1 and ASP 31 CA in monomer 2 # # of an asymmetrical homodimer, duplex # # DNA assignments, or other assignments # # that may apply to atoms in one or more # # molecule in the molecular assembly) # # 9 Ambiguous, specific ambiguity not defined # # # ################################################################### save_assigned_chemical_shifts_3 _Assigned_chem_shift_list.Sf_category assigned_chemical_shifts _Assigned_chem_shift_list.Sf_framecode assigned_chemical_shifts_3 _Assigned_chem_shift_list.Entry_ID bmse010352 _Assigned_chem_shift_list.ID 3 _Assigned_chem_shift_list.Sample_condition_list_ID 1 _Assigned_chem_shift_list.Sample_condition_list_label $sample_conditions_1 _Assigned_chem_shift_list.Chem_shift_reference_ID 3 _Assigned_chem_shift_list.Chem_shift_reference_label $chem_shift_reference_3 _Assigned_chem_shift_list.Error_derivation_method ? _Assigned_chem_shift_list.Details ? loop_ _Chem_shift_experiment.Experiment_ID _Chem_shift_experiment.Experiment_name _Chem_shift_experiment.Sample_ID _Chem_shift_experiment.Sample_label _Chem_shift_experiment.Entry_ID _Chem_shift_experiment.Assigned_chem_shift_list_ID 5 '1D 1H' 3 $sample_3 bmse010352 3 6 '1D 13C' 3 $sample_3 bmse010352 3 stop_ loop_ _Chem_shift_software.Software_ID _Chem_shift_software.Software_label _Chem_shift_software.Method_ID _Chem_shift_software.Method_label _Chem_shift_software.Entry_ID _Chem_shift_software.Assigned_chem_shift_list_ID 1 $software_1 ? ? bmse010352 3 stop_ loop_ _Atom_chem_shift.ID _Atom_chem_shift.Assembly_atom_ID _Atom_chem_shift.Entity_assembly_ID _Atom_chem_shift.Entity_ID _Atom_chem_shift.Comp_index_ID _Atom_chem_shift.Seq_ID _Atom_chem_shift.Comp_ID _Atom_chem_shift.Atom_ID _Atom_chem_shift.Atom_type _Atom_chem_shift.Atom_isotope_number _Atom_chem_shift.Val _Atom_chem_shift.Val_err _Atom_chem_shift.Assign_fig_of_merit _Atom_chem_shift.Ambiguity_code _Atom_chem_shift.Occupancy _Atom_chem_shift.Resonance_ID _Atom_chem_shift.Auth_entity_assembly_ID _Atom_chem_shift.Auth_seq_ID _Atom_chem_shift.Auth_comp_ID _Atom_chem_shift.Auth_atom_ID _Atom_chem_shift.Details _Atom_chem_shift.Entry_ID _Atom_chem_shift.Assigned_chem_shift_list_ID 1 ? 1 1 1 1 1 C1 C 13 13.82 ? ? 1 ? ? ? ? ? BG ? bmse010352 3 2 ? 1 1 1 1 1 C6 C 13 24.18 ? ? 1 ? ? ? ? ? BB ? bmse010352 3 3 ? 1 1 1 1 1 C9 C 13 37.35 ? ? 1 ? ? ? ? ? A ? bmse010352 3 4 ? 1 1 1 1 1 C8 C 13 37.60 ? ? 1 ? ? ? ? ? BA ? bmse010352 3 5 ? 1 1 1 1 1 C2 C 13 55.91 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 3 6 ? 1 1 1 1 1 C3 C 13 55.91 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 3 7 ? 1 1 1 1 1 C4 C 13 55.97 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 3 8 ? 1 1 1 1 1 C5 C 13 55.97 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 3 9 ? 1 1 1 1 1 C13 C 13 61.88 ? ? 1 ? ? ? ? ? G ? bmse010352 3 10 ? 1 1 1 1 1 C16 C 13 83.32 ? ? 1 ? ? ? ? ? B ? bmse010352 3 11 ? 1 1 1 1 1 C9 C 13 105.67 ? ? 1 ? ? ? ? ? B2 ? bmse010352 3 12 ? 1 1 1 1 1 C10 C 13 105.67 ? ? 1 ? ? ? ? ? B6 ? bmse010352 3 13 ? 1 1 1 1 1 C11 C 13 106.89 ? ? 1 ? ? ? ? ? A2 ? bmse010352 3 14 ? 1 1 1 1 1 C12 C 13 106.89 ? ? 1 ? ? ? ? ? A6 ? bmse010352 3 15 ? 1 1 1 1 1 C15 C 13 128.54 ? ? 1 ? ? ? ? ? A1 ? bmse010352 3 16 ? 1 1 1 1 1 C22 C 13 133.46 ? ? 1 ? ? ? ? ? B4 ? bmse010352 3 17 ? 1 1 1 1 1 C21 C 13 133.70 ? ? 1 ? ? ? ? ? A4 ? bmse010352 3 18 ? 1 1 1 1 1 C14 C 13 137.61 ? ? 1 ? ? ? ? ? B1 ? bmse010352 3 19 ? 1 1 1 1 1 C17 C 13 147.65 ? ? 1 ? ? ? ? ? A3 ? bmse010352 3 20 ? 1 1 1 1 1 C18 C 13 147.65 ? ? 1 ? ? ? ? ? A5 ? bmse010352 3 21 ? 1 1 1 1 1 C19 C 13 152.79 ? ? 1 ? ? ? ? ? B3 ? bmse010352 3 22 ? 1 1 1 1 1 C20 C 13 152.79 ? ? 1 ? ? ? ? ? B5 ? bmse010352 3 23 ? 1 1 1 1 1 H31 H 1 0.879 ? ? 1 ? ? ? ? ? BG ? bmse010352 3 24 ? 1 1 1 1 1 H30 H 1 0.879 ? ? 1 ? ? ? ? ? BG ? bmse010352 3 25 ? 1 1 1 1 1 H32 H 1 0.879 ? ? 1 ? ? ? ? ? BG ? bmse010352 3 26 ? 1 1 1 1 1 H45 H 1 1.562 ? ? 1 ? ? ? ? ? BB ? bmse010352 3 27 ? 1 1 1 1 1 H46 H 1 1.562 ? ? 1 ? ? ? ? ? BB ? bmse010352 3 28 ? 1 1 1 1 1 H47 H 1 2.45 ? ? 1 ? ? ? ? ? BA ? bmse010352 3 29 ? 1 1 1 1 1 H48 H 1 2.45 ? ? 1 ? ? ? ? ? BA ? bmse010352 3 30 ? 1 1 1 1 1 H49 H 1 2.756 ? ? 1 ? ? ? ? ? A1 ? bmse010352 3 31 ? 1 1 1 1 1 H50 H 1 2.868 ? ? 1 ? ? ? ? ? A2 ? bmse010352 3 32 ? 1 1 1 1 1 H58 H 1 4.334 ? ? 1 ? ? ? ? ? GOH ? bmse010352 3 33 ? 1 1 1 1 1 H33 H 1 3.692 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 3 34 ? 1 1 1 1 1 H35 H 1 3.692 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 3 35 ? 1 1 1 1 1 H34 H 1 3.692 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 3 36 ? 1 1 1 1 1 H36 H 1 3.692 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 3 37 ? 1 1 1 1 1 H37 H 1 3.692 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 3 38 ? 1 1 1 1 1 H38 H 1 3.692 ? ? 1 ? ? ? ? ? AOMe ? bmse010352 3 39 ? 1 1 1 1 1 H39 H 1 3.696 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 3 40 ? 1 1 1 1 1 H41 H 1 3.696 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 3 41 ? 1 1 1 1 1 H40 H 1 3.696 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 3 42 ? 1 1 1 1 1 H43 H 1 3.696 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 3 43 ? 1 1 1 1 1 H42 H 1 3.696 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 3 44 ? 1 1 1 1 1 H44 H 1 3.696 ? ? 1 ? ? ? ? ? BOMe ? bmse010352 3 45 ? 1 1 1 1 1 H57 H 1 4.103 ? ? 1 ? ? ? ? ? B ? bmse010352 3 46 ? 1 1 1 1 1 H51 H 1 6.449 ? ? 1 ? ? ? ? ? B2 ? bmse010352 3 47 ? 1 1 1 1 1 H52 H 1 6.449 ? ? 1 ? ? ? ? ? B6 ? bmse010352 3 48 ? 1 1 1 1 1 H53 H 1 6.462 ? ? 1 ? ? ? ? ? A2 ? bmse010352 3 49 ? 1 1 1 1 1 H54 H 1 6.462 ? ? 1 ? ? ? ? ? A6 ? bmse010352 3 50 ? 1 1 1 1 1 H59 H 1 8.044 ? ? 1 ? ? ? ? ? ArOH ? bmse010352 3 stop_ save_